C17H35NO2 — CID 155531919
[(2R,4S)-4-dodecoxypyrrolidin-2-yl]methanol (PubChem CID 155531919) has the molecular formula C17H35NO2 and a molecular weight of 285.47 g/mol. Its IUPAC name is [(2R,4S)-4-dodecoxypyrrolidin-2-yl]methanol.
| Compound Name | [(2R,4S)-4-dodecoxypyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 155531919 |
| Molecular Formula | C17H35NO2 |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.27 |
| IUPAC Name | [(2R,4S)-4-dodecoxypyrrolidin-2-yl]methanol |
| SMILES | CCCCCCCCCCCCO[C@@H]1CN[C@@H](CO)C1 |
| InChI | InChI=1S/C17H35NO2/c1-2-3-4-5-6-7-8-9-10-11-12-20-17-13-16(15-19)18-14-17/h16-19H,2-15H2,1H3/t16-,17+/m1/s1 |
| InChIKey | CWALPWATEWFJFN-SJORKVTESA-N |
| XLogP | 3.65 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|