C22H37NO2 — CID 155558450
[(2S,4R)-4-[(4-decylphenyl)methoxy]pyrrolidin-2-yl]methanol (PubChem CID 155558450) has the molecular formula C22H37NO2 and a molecular weight of 347.54 g/mol. Its IUPAC name is [(2S,4R)-4-[(4-decylphenyl)methoxy]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S,4R)-4-[(4-decylphenyl)methoxy]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 155558450 |
| Molecular Formula | C22H37NO2 |
| Molecular Weight | 347.54 g/mol |
| Exact Mass | 347.28 |
| IUPAC Name | [(2S,4R)-4-[(4-decylphenyl)methoxy]pyrrolidin-2-yl]methanol |
| SMILES | CCCCCCCCCCc1ccc(CO[C@H]2CN[C@H](CO)C2)cc1 |
| InChI | InChI=1S/C22H37NO2/c1-2-3-4-5-6-7-8-9-10-19-11-13-20(14-12-19)18-25-22-15-21(17-24)23-16-22/h11-14,21-24H,2-10,15-18H2,1H3/t21-,22+/m0/s1 |
| InChIKey | PLHUWCXTZZQECV-FCHUYYIVSA-N |
| XLogP | 4.61 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|