C22H35NO3 — CID 155532474
1-[(2R,4S)-2-(hydroxymethyl)-4-[(4-octylphenyl)methoxy]pyrrolidin-1-yl]ethanone (PubChem CID 155532474) has the molecular formula C22H35NO3 and a molecular weight of 361.53 g/mol. Its IUPAC name is 1-[(2R,4S)-2-(hydroxymethyl)-4-[(4-octylphenyl)methoxy]pyrrolidin-1-yl]ethanone.
| Compound Name | 1-[(2R,4S)-2-(hydroxymethyl)-4-[(4-octylphenyl)methoxy]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 155532474 |
| Molecular Formula | C22H35NO3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | 1-[(2R,4S)-2-(hydroxymethyl)-4-[(4-octylphenyl)methoxy]pyrrolidin-1-yl]ethanone |
| SMILES | CCCCCCCCc1ccc(CO[C@H]2C[C@H](CO)N(C(C)=O)C2)cc1 |
| InChI | InChI=1S/C22H35NO3/c1-3-4-5-6-7-8-9-19-10-12-20(13-11-19)17-26-22-14-21(16-24)23(15-22)18(2)25/h10-13,21-22,24H,3-9,14-17H2,1-2H3/t21-,22+/m1/s1 |
| InChIKey | BRKAUTKLTDJUKD-YADHBBJMSA-N |
| XLogP | 4.09 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|