C21H28FNO — CID 19613183
(E)-2-fluoro-3-[4-[(4-pentylphenyl)methoxy]cyclohexyl]prop-2-enenitrile (PubChem CID 19613183) has the molecular formula C21H28FNO and a molecular weight of 329.46 g/mol. Its IUPAC name is (E)-2-fluoro-3-[4-[(4-pentylphenyl)methoxy]cyclohexyl]prop-2-enenitrile.
| Compound Name | (E)-2-fluoro-3-[4-[(4-pentylphenyl)methoxy]cyclohexyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 19613183 |
| Molecular Formula | C21H28FNO |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | (E)-2-fluoro-3-[4-[(4-pentylphenyl)methoxy]cyclohexyl]prop-2-enenitrile |
| SMILES | CCCCCc1ccc(COC2CCC(/C=C(/F)C#N)CC2)cc1 |
| InChI | InChI=1S/C21H28FNO/c1-2-3-4-5-17-6-8-19(9-7-17)16-24-21-12-10-18(11-13-21)14-20(22)15-23/h6-9,14,18,21H,2-5,10-13,16H2,1H3/b20-14+ |
| InChIKey | HDKWFGJMZVNZAN-XSFVSMFZSA-N |
| XLogP | 5.87 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|