C29H42FNO — CID 19612761
(E)-2-fluoro-3-[4-[[4-(4-heptylphenyl)cyclohexyl]methoxy]cyclohexyl]prop-2-enenitrile (PubChem CID 19612761) has the molecular formula C29H42FNO and a molecular weight of 439.66 g/mol. Its IUPAC name is (E)-2-fluoro-3-[4-[[4-(4-heptylphenyl)cyclohexyl]methoxy]cyclohexyl]prop-2-enenitrile.
| Compound Name | (E)-2-fluoro-3-[4-[[4-(4-heptylphenyl)cyclohexyl]methoxy]cyclohexyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 19612761 |
| Molecular Formula | C29H42FNO |
| Molecular Weight | 439.66 g/mol |
| Exact Mass | 439.33 |
| IUPAC Name | (E)-2-fluoro-3-[4-[[4-(4-heptylphenyl)cyclohexyl]methoxy]cyclohexyl]prop-2-enenitrile |
| SMILES | CCCCCCCc1ccc(C2CCC(COC3CCC(/C=C(/F)C#N)CC3)CC2)cc1 |
| InChI | InChI=1S/C29H42FNO/c1-2-3-4-5-6-7-23-8-14-26(15-9-23)27-16-10-25(11-17-27)22-32-29-18-12-24(13-19-29)20-28(30)21-31/h8-9,14-15,20,24-25,27,29H,2-7,10-13,16-19,22H2,1H3/b28-20+ |
| InChIKey | AGTZSQRBSZRCAV-VFCFBJKWSA-N |
| XLogP | 8.43 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.66 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|