C24H33NO — CID 19612905
(E)-3-[4-[[4-(4-ethylphenyl)cyclohexyl]methoxy]cyclohexyl]prop-2-enenitrile (PubChem CID 19612905) has the molecular formula C24H33NO and a molecular weight of 351.53 g/mol. Its IUPAC name is (E)-3-[4-[[4-(4-ethylphenyl)cyclohexyl]methoxy]cyclohexyl]prop-2-enenitrile.
| Compound Name | (E)-3-[4-[[4-(4-ethylphenyl)cyclohexyl]methoxy]cyclohexyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 19612905 |
| Molecular Formula | C24H33NO |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | (E)-3-[4-[[4-(4-ethylphenyl)cyclohexyl]methoxy]cyclohexyl]prop-2-enenitrile |
| SMILES | CCc1ccc(C2CCC(COC3CCC(/C=C/C#N)CC3)CC2)cc1 |
| InChI | InChI=1S/C24H33NO/c1-2-19-5-11-22(12-6-19)23-13-7-21(8-14-23)18-26-24-15-9-20(10-16-24)4-3-17-25/h3-6,11-12,20-21,23-24H,2,7-10,13-16,18H2,1H3/b4-3+ |
| InChIKey | XFZWDKKPYIPKBR-ONEGZZNKSA-N |
| XLogP | 6.18 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|