C20H25NO — CID 56627834
5-[4-[(4-ethylphenyl)methoxy]cyclohexyl]penta-2,4-dienenitrile (PubChem CID 56627834) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is 5-[4-[(4-ethylphenyl)methoxy]cyclohexyl]penta-2,4-dienenitrile.
| Compound Name | 5-[4-[(4-ethylphenyl)methoxy]cyclohexyl]penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 56627834 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 5-[4-[(4-ethylphenyl)methoxy]cyclohexyl]penta-2,4-dienenitrile |
| SMILES | CCc1ccc(COC2CCC(C=CC=CC#N)CC2)cc1 |
| InChI | InChI=1S/C20H25NO/c1-2-17-7-9-19(10-8-17)16-22-20-13-11-18(12-14-20)6-4-3-5-15-21/h3-10,18,20H,2,11-14,16H2,1H3 |
| InChIKey | AJCZACIYVGZDJQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|