C21H24F3NO2 — CID 54492159
7-[4-[[4-(trifluoromethoxy)phenyl]methoxy]cyclohexyl]hepta-2,4-dienenitrile (PubChem CID 54492159) has the molecular formula C21H24F3NO2 and a molecular weight of 379.42 g/mol. Its IUPAC name is 7-[4-[[4-(trifluoromethoxy)phenyl]methoxy]cyclohexyl]hepta-2,4-dienenitrile.
| Compound Name | 7-[4-[[4-(trifluoromethoxy)phenyl]methoxy]cyclohexyl]hepta-2,4-dienenitrile |
|---|---|
| PubChem CID | 54492159 |
| Molecular Formula | C21H24F3NO2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 7-[4-[[4-(trifluoromethoxy)phenyl]methoxy]cyclohexyl]hepta-2,4-dienenitrile |
| SMILES | N#CC=CC=CCCC1CCC(OCc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C21H24F3NO2/c22-21(23,24)27-20-13-9-18(10-14-20)16-26-19-11-7-17(8-12-19)6-4-2-1-3-5-15-25/h1-3,5,9-10,13-14,17,19H,4,6-8,11-12,16H2 |
| InChIKey | XWMNHVYGUQHVKP-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|