C20H30F3NO2 — CID 143734022
[(2S,4R)-4-[4-octyl-3-(trifluoromethyl)phenoxy]pyrrolidin-2-yl]methanol (PubChem CID 143734022) has the molecular formula C20H30F3NO2 and a molecular weight of 373.46 g/mol. Its IUPAC name is [(2S,4R)-4-[4-octyl-3-(trifluoromethyl)phenoxy]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S,4R)-4-[4-octyl-3-(trifluoromethyl)phenoxy]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 143734022 |
| Molecular Formula | C20H30F3NO2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | [(2S,4R)-4-[4-octyl-3-(trifluoromethyl)phenoxy]pyrrolidin-2-yl]methanol |
| SMILES | CCCCCCCCc1ccc(O[C@H]2CN[C@H](CO)C2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H30F3NO2/c1-2-3-4-5-6-7-8-15-9-10-17(12-19(15)20(21,22)23)26-18-11-16(14-25)24-13-18/h9-10,12,16,18,24-25H,2-8,11,13-14H2,1H3/t16-,18+/m0/s1 |
| InChIKey | LZRZEWFAKNYHNM-FUHWJXTLSA-N |
| XLogP | 4.71 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|