C19H29F3NO5P — CID 143734012
[(2S,4R)-4-[4-heptyl-3-(trifluoromethyl)phenoxy]pyrrolidin-2-yl]methyl dihydrogen phosphate (PubChem CID 143734012) has the molecular formula C19H29F3NO5P and a molecular weight of 439.41 g/mol. Its IUPAC name is [(2S,4R)-4-[4-heptyl-3-(trifluoromethyl)phenoxy]pyrrolidin-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2S,4R)-4-[4-heptyl-3-(trifluoromethyl)phenoxy]pyrrolidin-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 143734012 |
| Molecular Formula | C19H29F3NO5P |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | [(2S,4R)-4-[4-heptyl-3-(trifluoromethyl)phenoxy]pyrrolidin-2-yl]methyl dihydrogen phosphate |
| SMILES | CCCCCCCc1ccc(O[C@H]2CN[C@H](COP(=O)(O)O)C2)cc1C(F)(F)F |
| InChI | InChI=1S/C19H29F3NO5P/c1-2-3-4-5-6-7-14-8-9-16(11-18(14)19(20,21)22)28-17-10-15(23-12-17)13-27-29(24,25)26/h8-9,11,15,17,23H,2-7,10,12-13H2,1H3,(H2,24,25,26)/t15-,17+/m0/s1 |
| InChIKey | KHOJHXSTEAJZGM-DOTOQJQBSA-N |
| XLogP | 4.44 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|