C20H33N2O5P — CID 137481247
[1-[(3-amino-4-octylphenyl)methyl]-2-oxopyrrolidin-3-yl]methyl dihydrogen phosphate (PubChem CID 137481247) has the molecular formula C20H33N2O5P and a molecular weight of 412.47 g/mol. Its IUPAC name is [1-[(3-amino-4-octylphenyl)methyl]-2-oxopyrrolidin-3-yl]methyl dihydrogen phosphate.
| Compound Name | [1-[(3-amino-4-octylphenyl)methyl]-2-oxopyrrolidin-3-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 137481247 |
| Molecular Formula | C20H33N2O5P |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | [1-[(3-amino-4-octylphenyl)methyl]-2-oxopyrrolidin-3-yl]methyl dihydrogen phosphate |
| SMILES | CCCCCCCCc1ccc(CN2CCC(COP(=O)(O)O)C2=O)cc1N |
| InChI | InChI=1S/C20H33N2O5P/c1-2-3-4-5-6-7-8-17-10-9-16(13-19(17)21)14-22-12-11-18(20(22)23)15-27-28(24,25)26/h9-10,13,18H,2-8,11-12,14-15,21H2,1H3,(H2,24,25,26) |
| InChIKey | LVBVOPKKJZXLCA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|