C19H32NO4P — CID 68942543
[(1S,3S)-1-amino-3-(4-heptylphenyl)cyclopentyl]methyl dihydrogen phosphate (PubChem CID 68942543) has the molecular formula C19H32NO4P and a molecular weight of 369.44 g/mol. Its IUPAC name is [(1S,3S)-1-amino-3-(4-heptylphenyl)cyclopentyl]methyl dihydrogen phosphate.
| Compound Name | [(1S,3S)-1-amino-3-(4-heptylphenyl)cyclopentyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 68942543 |
| Molecular Formula | C19H32NO4P |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | [(1S,3S)-1-amino-3-(4-heptylphenyl)cyclopentyl]methyl dihydrogen phosphate |
| SMILES | CCCCCCCc1ccc([C@H]2CC[C@@](N)(COP(=O)(O)O)C2)cc1 |
| InChI | InChI=1S/C19H32NO4P/c1-2-3-4-5-6-7-16-8-10-17(11-9-16)18-12-13-19(20,14-18)15-24-25(21,22)23/h8-11,18H,2-7,12-15,20H2,1H3,(H2,21,22,23)/t18-,19-/m0/s1 |
| InChIKey | DOFJYHFKXRFPAW-OALUTQOASA-N |
| XLogP | 4.27 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|