C21H33NO3 — CID 68939894
[(1R,3S)-1-(hydroxymethyl)-3-(4-octylphenyl)cyclopentyl]carbamic acid (PubChem CID 68939894) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is [(1R,3S)-1-(hydroxymethyl)-3-(4-octylphenyl)cyclopentyl]carbamic acid.
| Compound Name | [(1R,3S)-1-(hydroxymethyl)-3-(4-octylphenyl)cyclopentyl]carbamic acid |
|---|---|
| PubChem CID | 68939894 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | [(1R,3S)-1-(hydroxymethyl)-3-(4-octylphenyl)cyclopentyl]carbamic acid |
| SMILES | CCCCCCCCc1ccc([C@H]2CC[C@@](CO)(NC(=O)O)C2)cc1 |
| InChI | InChI=1S/C21H33NO3/c1-2-3-4-5-6-7-8-17-9-11-18(12-10-17)19-13-14-21(15-19,16-23)22-20(24)25/h9-12,19,22-23H,2-8,13-16H2,1H3,(H,24,25)/t19-,21+/m0/s1 |
| InChIKey | HBVAUDHZVCJOOT-PZJWPPBQSA-N |
| XLogP | 4.86 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|