C51H88N2O8P2 — CID 159372513
2-[(1R,3S)-1-amino-3-(4-octylphenyl)cyclopentyl]ethylphosphonic acid;tert-butyl N-[(1R)-1-(2-diethoxyphosphorylethyl)-3-(4-octylphenyl)cyclopentyl]carbamate (PubChem CID 159372513) has the molecular formula C51H88N2O8P2 and a molecular weight of 919.22 g/mol. Its IUPAC name is 2-[(1R,3S)-1-amino-3-(4-octylphenyl)cyclopentyl]ethylphosphonic acid;tert-butyl N-[(1R)-1-(2-diethoxyphosphorylethyl)-3-(4-octylphenyl)cyclopentyl]carbamate.
| Compound Name | 2-[(1R,3S)-1-amino-3-(4-octylphenyl)cyclopentyl]ethylphosphonic acid;tert-butyl N-[(1R)-1-(2-diethoxyphosphorylethyl)-3-(4-octylphenyl)cyclopentyl]carbamate |
|---|---|
| PubChem CID | 159372513 |
| Molecular Formula | C51H88N2O8P2 |
| Molecular Weight | 919.22 g/mol |
| Exact Mass | 918.60 |
| IUPAC Name | 2-[(1R,3S)-1-amino-3-(4-octylphenyl)cyclopentyl]ethylphosphonic acid;tert-butyl N-[(1R)-1-(2-diethoxyphosphorylethyl)-3-(4-octylphenyl)cyclopentyl]carbamate |
| SMILES | CCCCCCCCc1ccc(C2CC[C@@](CCP(=O)(OCC)OCC)(NC(=O)OC(C)(C)C)C2)cc1.CCCCCCCCc1ccc([C@H]2CC[C@](N)(CCP(=O)(O)O)C2)cc1 |
| InChI | InChI=1S/C30H52NO5P.C21H36NO3P/c1-7-10-11-12-13-14-15-25-16-18-26(19-17-25)27-20-21-30(24-27,31-28(32)36-29(4,5)6)22-23-37(33,34-8-2)35-9-3;1-2-3-4-5-6-7-8-18-9-11-19(12-10-18)20-13-14-21(22,17-20)15-16-26(23,24)25/h16-19,27H,7-15,20-24H2,1-6H3,(H,31,32);9-12,20H,2-8,13-17,22H2,1H3,(H2,23,24,25)/t27?,30-;20-,21-/m00/s1 |
| InChIKey | LJXMBKVBKPTJAT-VYZIJLEFSA-N |
| XLogP | 13.90 |
| TPSA | 157.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.22 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|