C22H32NO4P — CID 131953771
[(1R,3S)-1-amino-3-[6-[(E)-hex-1-enyl]-7,8-dihydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate (PubChem CID 131953771) has the molecular formula C22H32NO4P and a molecular weight of 405.48 g/mol. Its IUPAC name is [(1R,3S)-1-amino-3-[6-[(E)-hex-1-enyl]-7,8-dihydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate.
| Compound Name | [(1R,3S)-1-amino-3-[6-[(E)-hex-1-enyl]-7,8-dihydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 131953771 |
| Molecular Formula | C22H32NO4P |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | [(1R,3S)-1-amino-3-[6-[(E)-hex-1-enyl]-7,8-dihydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
| SMILES | CCCC/C=C/C1=Cc2ccc([C@H]3CC[C@](N)(COP(=O)(O)O)C3)cc2CC1 |
| InChI | InChI=1S/C22H32NO4P/c1-2-3-4-5-6-17-7-8-19-14-20(10-9-18(19)13-17)21-11-12-22(23,15-21)16-27-28(24,25)26/h5-6,9-10,13-14,21H,2-4,7-8,11-12,15-16,23H2,1H3,(H2,24,25,26)/b6-5+/t21-,22+/m0/s1 |
| InChIKey | KWRRNBCZIGUXKL-XPBWLIJGSA-N |
| XLogP | 4.84 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|