C23H29F3NO5PS — CID 131953639
[(1R,3S)-1-amino-3-[(6R)-6-[[5-(trifluoromethyl)thiophen-2-yl]methoxymethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate (PubChem CID 131953639) has the molecular formula C23H29F3NO5PS and a molecular weight of 519.52 g/mol. Its IUPAC name is [(1R,3S)-1-amino-3-[(6R)-6-[[5-(trifluoromethyl)thiophen-2-yl]methoxymethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate.
| Compound Name | [(1R,3S)-1-amino-3-[(6R)-6-[[5-(trifluoromethyl)thiophen-2-yl]methoxymethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 131953639 |
| Molecular Formula | C23H29F3NO5PS |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | [(1R,3S)-1-amino-3-[(6R)-6-[[5-(trifluoromethyl)thiophen-2-yl]methoxymethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
| SMILES | N[C@]1(COP(=O)(O)O)CC[C@H](c2ccc3c(c2)CC[C@@H](COCc2ccc(C(F)(F)F)s2)C3)C1 |
| InChI | InChI=1S/C23H29F3NO5PS/c24-23(25,26)21-6-5-20(34-21)13-31-12-15-1-2-17-10-18(4-3-16(17)9-15)19-7-8-22(27,11-19)14-32-33(28,29)30/h3-6,10,15,19H,1-2,7-9,11-14,27H2,(H2,28,29,30)/t15-,19+,22-/m1/s1 |
| InChIKey | KYFDSQMEIONXOB-QOEFQVSFSA-N |
| XLogP | 5.16 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|