C25H34NO6P — CID 131953626
[(1R,3S)-1-amino-3-[(6R)-6-[(4-methoxyphenyl)methoxymethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate (PubChem CID 131953626) has the molecular formula C25H34NO6P and a molecular weight of 475.52 g/mol. Its IUPAC name is [(1R,3S)-1-amino-3-[(6R)-6-[(4-methoxyphenyl)methoxymethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate.
| Compound Name | [(1R,3S)-1-amino-3-[(6R)-6-[(4-methoxyphenyl)methoxymethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 131953626 |
| Molecular Formula | C25H34NO6P |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | [(1R,3S)-1-amino-3-[(6R)-6-[(4-methoxyphenyl)methoxymethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
| SMILES | COc1ccc(COC[C@@H]2CCc3cc([C@H]4CC[C@](N)(COP(=O)(O)O)C4)ccc3C2)cc1 |
| InChI | InChI=1S/C25H34NO6P/c1-30-24-8-3-18(4-9-24)15-31-16-19-2-5-21-13-22(7-6-20(21)12-19)23-10-11-25(26,14-23)17-32-33(27,28)29/h3-4,6-9,13,19,23H,2,5,10-12,14-17,26H2,1H3,(H2,27,28,29)/t19-,23+,25-/m1/s1 |
| InChIKey | ULNFEWXZLLVANY-HFRGRHLUSA-N |
| XLogP | 4.09 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|