C20H32NO4PS — CID 131953642
[(1R,3S)-1-amino-3-[(6S)-6-(propylsulfanylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate (PubChem CID 131953642) has the molecular formula C20H32NO4PS and a molecular weight of 413.52 g/mol. Its IUPAC name is [(1R,3S)-1-amino-3-[(6S)-6-(propylsulfanylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate.
| Compound Name | [(1R,3S)-1-amino-3-[(6S)-6-(propylsulfanylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 131953642 |
| Molecular Formula | C20H32NO4PS |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | [(1R,3S)-1-amino-3-[(6S)-6-(propylsulfanylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
| SMILES | CCCSC[C@H]1CCc2cc([C@H]3CC[C@](N)(COP(=O)(O)O)C3)ccc2C1 |
| InChI | InChI=1S/C20H32NO4PS/c1-2-9-27-13-15-3-4-17-11-18(6-5-16(17)10-15)19-7-8-20(21,12-19)14-25-26(22,23)24/h5-6,11,15,19H,2-4,7-10,12-14,21H2,1H3,(H2,22,23,24)/t15-,19-,20+/m0/s1 |
| InChIKey | OMMSZTZBZYAWCH-RYGJVYDSSA-N |
| XLogP | 4.01 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|