C27H44NO5P — CID 131953633
[(1R,3S)-1-amino-3-[(6R)-6-[(3,3,5,5-tetramethylcyclohexyl)oxymethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate (PubChem CID 131953633) has the molecular formula C27H44NO5P and a molecular weight of 493.63 g/mol. Its IUPAC name is [(1R,3S)-1-amino-3-[(6R)-6-[(3,3,5,5-tetramethylcyclohexyl)oxymethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate.
| Compound Name | [(1R,3S)-1-amino-3-[(6R)-6-[(3,3,5,5-tetramethylcyclohexyl)oxymethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 131953633 |
| Molecular Formula | C27H44NO5P |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.30 |
| IUPAC Name | [(1R,3S)-1-amino-3-[(6R)-6-[(3,3,5,5-tetramethylcyclohexyl)oxymethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
| SMILES | CC1(C)CC(OC[C@@H]2CCc3cc([C@H]4CC[C@](N)(COP(=O)(O)O)C4)ccc3C2)CC(C)(C)C1 |
| InChI | InChI=1S/C27H44NO5P/c1-25(2)14-24(15-26(3,4)17-25)32-16-19-5-6-21-12-22(8-7-20(21)11-19)23-9-10-27(28,13-23)18-33-34(29,30)31/h7-8,12,19,23-24H,5-6,9-11,13-18,28H2,1-4H3,(H2,29,30,31)/t19-,23+,27-/m1/s1 |
| InChIKey | TVVZUINHCYQMNU-VQEMNGCCSA-N |
| XLogP | 5.49 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|