C23H31N2O4P — CID 138106758
[(1R,3S)-1-amino-3-[(6S)-6-(2-pyridin-3-ylethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate (PubChem CID 138106758) has the molecular formula C23H31N2O4P and a molecular weight of 430.49 g/mol. Its IUPAC name is [(1R,3S)-1-amino-3-[(6S)-6-(2-pyridin-3-ylethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate.
| Compound Name | [(1R,3S)-1-amino-3-[(6S)-6-(2-pyridin-3-ylethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 138106758 |
| Molecular Formula | C23H31N2O4P |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | [(1R,3S)-1-amino-3-[(6S)-6-(2-pyridin-3-ylethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
| SMILES | N[C@]1(COP(=O)(O)O)CC[C@H](c2ccc3c(c2)CC[C@@H](CCc2cccnc2)C3)C1 |
| InChI | InChI=1S/C23H31N2O4P/c24-23(16-29-30(26,27)28)10-9-22(14-23)21-8-7-19-12-17(5-6-20(19)13-21)3-4-18-2-1-11-25-15-18/h1-2,7-8,11,13,15,17,22H,3-6,9-10,12,14,16,24H2,(H2,26,27,28)/t17-,22+,23-/m1/s1 |
| InChIKey | IKYHSCAEAWZKKI-MQNAVGNWSA-N |
| XLogP | 3.89 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|