C22H33NO2 — CID 175059384
[(1R,3S)-1-amino-3-[6-[2-(cyclopropylmethoxy)ethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol (PubChem CID 175059384) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is [(1R,3S)-1-amino-3-[6-[2-(cyclopropylmethoxy)ethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol.
| Compound Name | [(1R,3S)-1-amino-3-[6-[2-(cyclopropylmethoxy)ethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 175059384 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | [(1R,3S)-1-amino-3-[6-[2-(cyclopropylmethoxy)ethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol |
| SMILES | N[C@]1(CO)CC[C@H](c2ccc3c(c2)CCC(CCOCC2CC2)C3)C1 |
| InChI | InChI=1S/C22H33NO2/c23-22(15-24)9-7-21(13-22)20-6-5-18-11-16(3-4-19(18)12-20)8-10-25-14-17-1-2-17/h5-6,12,16-17,21,24H,1-4,7-11,13-15,23H2/t16?,21-,22+/m0/s1 |
| InChIKey | DIIXTAZLECETHO-APFNHRKESA-N |
| XLogP | 3.57 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|