C22H33NO — CID 118877304
[(1R,3S)-1-amino-3-[6-[(E)-hex-3-enyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol (PubChem CID 118877304) has the molecular formula C22H33NO and a molecular weight of 327.51 g/mol. Its IUPAC name is [(1R,3S)-1-amino-3-[6-[(E)-hex-3-enyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol.
| Compound Name | [(1R,3S)-1-amino-3-[6-[(E)-hex-3-enyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 118877304 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | [(1R,3S)-1-amino-3-[6-[(E)-hex-3-enyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol |
| SMILES | CC/C=C/CCC1CCc2cc([C@H]3CC[C@](N)(CO)C3)ccc2C1 |
| InChI | InChI=1S/C22H33NO/c1-2-3-4-5-6-17-7-8-19-14-20(10-9-18(19)13-17)21-11-12-22(23,15-21)16-24/h3-4,9-10,14,17,21,24H,2,5-8,11-13,15-16,23H2,1H3/b4-3+/t17?,21-,22+/m0/s1 |
| InChIKey | VRMKLXBPNWRVSL-MCKMVCLSSA-N |
| XLogP | 4.50 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|