C25H33NO4 — CID 175065518
[(1R,3S)-1-amino-3-[6-[(3,4-dimethoxyphenoxy)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol (PubChem CID 175065518) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is [(1R,3S)-1-amino-3-[6-[(3,4-dimethoxyphenoxy)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol.
| Compound Name | [(1R,3S)-1-amino-3-[6-[(3,4-dimethoxyphenoxy)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 175065518 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | [(1R,3S)-1-amino-3-[6-[(3,4-dimethoxyphenoxy)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol |
| SMILES | COc1ccc(OCC2CCc3cc([C@H]4CC[C@](N)(CO)C4)ccc3C2)cc1OC |
| InChI | InChI=1S/C25H33NO4/c1-28-23-8-7-22(13-24(23)29-2)30-15-17-3-4-19-12-20(6-5-18(19)11-17)21-9-10-25(26,14-21)16-27/h5-8,12-13,17,21,27H,3-4,9-11,14-16,26H2,1-2H3/t17?,21-,25+/m0/s1 |
| InChIKey | JPAINYJOXKSITN-MHQFRCHTSA-N |
| XLogP | 3.85 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |