C24H29F2NO3 — CID 175065045
[(1R,3S)-1-amino-3-[6-[(2,3-difluoro-4-methoxyphenoxy)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol (PubChem CID 175065045) has the molecular formula C24H29F2NO3 and a molecular weight of 417.50 g/mol. Its IUPAC name is [(1R,3S)-1-amino-3-[6-[(2,3-difluoro-4-methoxyphenoxy)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol.
| Compound Name | [(1R,3S)-1-amino-3-[6-[(2,3-difluoro-4-methoxyphenoxy)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 175065045 |
| Molecular Formula | C24H29F2NO3 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | [(1R,3S)-1-amino-3-[6-[(2,3-difluoro-4-methoxyphenoxy)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol |
| SMILES | COc1ccc(OCC2CCc3cc([C@H]4CC[C@](N)(CO)C4)ccc3C2)c(F)c1F |
| InChI | InChI=1S/C24H29F2NO3/c1-29-20-6-7-21(23(26)22(20)25)30-13-15-2-3-17-11-18(5-4-16(17)10-15)19-8-9-24(27,12-19)14-28/h4-7,11,15,19,28H,2-3,8-10,12-14,27H2,1H3/t15?,19-,24+/m0/s1 |
| InChIKey | QDODESOGZNODNS-QJZMUREISA-N |
| XLogP | 4.11 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |