C19H31NO2 — CID 68940187
[(1S,3R)-1-amino-3-(4-heptoxyphenyl)cyclopentyl]methanol (PubChem CID 68940187) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is [(1S,3R)-1-amino-3-(4-heptoxyphenyl)cyclopentyl]methanol.
| Compound Name | [(1S,3R)-1-amino-3-(4-heptoxyphenyl)cyclopentyl]methanol |
|---|---|
| PubChem CID | 68940187 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | [(1S,3R)-1-amino-3-(4-heptoxyphenyl)cyclopentyl]methanol |
| SMILES | CCCCCCCOc1ccc([C@@H]2CC[C@@](N)(CO)C2)cc1 |
| InChI | InChI=1S/C19H31NO2/c1-2-3-4-5-6-13-22-18-9-7-16(8-10-18)17-11-12-19(20,14-17)15-21/h7-10,17,21H,2-6,11-15,20H2,1H3/t17-,19+/m1/s1 |
| InChIKey | YNPVHXZATAYGFT-MJGOQNOKSA-N |
| XLogP | 3.99 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|