C18H25NO — CID 68941625
[(1S,3R)-1-amino-3-(4-hex-1-ynylphenyl)cyclopentyl]methanol (PubChem CID 68941625) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is [(1S,3R)-1-amino-3-(4-hex-1-ynylphenyl)cyclopentyl]methanol.
| Compound Name | [(1S,3R)-1-amino-3-(4-hex-1-ynylphenyl)cyclopentyl]methanol |
|---|---|
| PubChem CID | 68941625 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | [(1S,3R)-1-amino-3-(4-hex-1-ynylphenyl)cyclopentyl]methanol |
| SMILES | CCCCC#Cc1ccc([C@@H]2CC[C@@](N)(CO)C2)cc1 |
| InChI | InChI=1S/C18H25NO/c1-2-3-4-5-6-15-7-9-16(10-8-15)17-11-12-18(19,13-17)14-20/h7-10,17,20H,2-4,11-14,19H2,1H3/t17-,18+/m1/s1 |
| InChIKey | AZCQMYKAAGUCGU-MSOLQXFVSA-N |
| XLogP | 3.19 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|