C20H25NO2 — CID 141211633
[(1R,3R)-1-amino-3-[4-(2-phenylethoxy)phenyl]cyclopentyl]methanol (PubChem CID 141211633) has the molecular formula C20H25NO2 and a molecular weight of 311.42 g/mol. Its IUPAC name is [(1R,3R)-1-amino-3-[4-(2-phenylethoxy)phenyl]cyclopentyl]methanol.
| Compound Name | [(1R,3R)-1-amino-3-[4-(2-phenylethoxy)phenyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 141211633 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | [(1R,3R)-1-amino-3-[4-(2-phenylethoxy)phenyl]cyclopentyl]methanol |
| SMILES | N[C@]1(CO)CC[C@@H](c2ccc(OCCc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C20H25NO2/c21-20(15-22)12-10-18(14-20)17-6-8-19(9-7-17)23-13-11-16-4-2-1-3-5-16/h1-9,18,22H,10-15,21H2/t18-,20-/m1/s1 |
| InChIKey | UJRYFSHELSGTLC-UYAOXDASSA-N |
| XLogP | 3.27 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |