C19H25NO2S — CID 68934675
[(1S,3R)-1-amino-3-[4-(3-thiophen-2-ylpropoxy)phenyl]cyclopentyl]methanol (PubChem CID 68934675) has the molecular formula C19H25NO2S and a molecular weight of 331.48 g/mol. Its IUPAC name is [(1S,3R)-1-amino-3-[4-(3-thiophen-2-ylpropoxy)phenyl]cyclopentyl]methanol.
| Compound Name | [(1S,3R)-1-amino-3-[4-(3-thiophen-2-ylpropoxy)phenyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 68934675 |
| Molecular Formula | C19H25NO2S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | [(1S,3R)-1-amino-3-[4-(3-thiophen-2-ylpropoxy)phenyl]cyclopentyl]methanol |
| SMILES | N[C@@]1(CO)CC[C@@H](c2ccc(OCCCc3cccs3)cc2)C1 |
| InChI | InChI=1S/C19H25NO2S/c20-19(14-21)10-9-16(13-19)15-5-7-17(8-6-15)22-11-1-3-18-4-2-12-23-18/h2,4-8,12,16,21H,1,3,9-11,13-14,20H2/t16-,19+/m1/s1 |
| InChIKey | FFLNQLITYGSTIL-APWZRJJASA-N |
| XLogP | 3.72 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|