C20H33NO — CID 25009740
[(3S)-1-amino-3-(4-octylphenyl)cyclopentyl]methanol (PubChem CID 25009740) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is [(3S)-1-amino-3-(4-octylphenyl)cyclopentyl]methanol.
| Compound Name | [(3S)-1-amino-3-(4-octylphenyl)cyclopentyl]methanol |
|---|---|
| PubChem CID | 25009740 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | [(3S)-1-amino-3-(4-octylphenyl)cyclopentyl]methanol |
| SMILES | CCCCCCCCc1ccc([C@H]2CCC(N)(CO)C2)cc1 |
| InChI | InChI=1S/C20H33NO/c1-2-3-4-5-6-7-8-17-9-11-18(12-10-17)19-13-14-20(21,15-19)16-22/h9-12,19,22H,2-8,13-16,21H2,1H3/t19-,20?/m0/s1 |
| InChIKey | BLASFTPNKGQBNF-XJDOXCRVSA-N |
| XLogP | 4.55 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|