C18H31NOS — CID 46853547
[(1R,3S)-1-amino-3-(5-octylthiophen-2-yl)cyclopentyl]methanol (PubChem CID 46853547) has the molecular formula C18H31NOS and a molecular weight of 309.52 g/mol. Its IUPAC name is [(1R,3S)-1-amino-3-(5-octylthiophen-2-yl)cyclopentyl]methanol.
| Compound Name | [(1R,3S)-1-amino-3-(5-octylthiophen-2-yl)cyclopentyl]methanol |
|---|---|
| PubChem CID | 46853547 |
| Molecular Formula | C18H31NOS |
| Molecular Weight | 309.52 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | [(1R,3S)-1-amino-3-(5-octylthiophen-2-yl)cyclopentyl]methanol |
| SMILES | CCCCCCCCc1ccc([C@H]2CC[C@](N)(CO)C2)s1 |
| InChI | InChI=1S/C18H31NOS/c1-2-3-4-5-6-7-8-16-9-10-17(21-16)15-11-12-18(19,13-15)14-20/h9-10,15,20H,2-8,11-14,19H2,1H3/t15-,18+/m0/s1 |
| InChIKey | UABBOESZKHVGIY-MAUKXSAKSA-N |
| XLogP | 4.61 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|