C20H27NOS — CID 46853562
[(1R,3S)-1-amino-3-[5-(4-phenylbutyl)thiophen-2-yl]cyclopentyl]methanol (PubChem CID 46853562) has the molecular formula C20H27NOS and a molecular weight of 329.51 g/mol. Its IUPAC name is [(1R,3S)-1-amino-3-[5-(4-phenylbutyl)thiophen-2-yl]cyclopentyl]methanol.
| Compound Name | [(1R,3S)-1-amino-3-[5-(4-phenylbutyl)thiophen-2-yl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 46853562 |
| Molecular Formula | C20H27NOS |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | [(1R,3S)-1-amino-3-[5-(4-phenylbutyl)thiophen-2-yl]cyclopentyl]methanol |
| SMILES | N[C@]1(CO)CC[C@H](c2ccc(CCCCc3ccccc3)s2)C1 |
| InChI | InChI=1S/C20H27NOS/c21-20(15-22)13-12-17(14-20)19-11-10-18(23-19)9-5-4-8-16-6-2-1-3-7-16/h1-3,6-7,10-11,17,22H,4-5,8-9,12-15,21H2/t17-,20+/m0/s1 |
| InChIKey | SVYYIHZUPGGMLZ-FXAWDEMLSA-N |
| XLogP | 4.27 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|