C23H32N2O2S — CID 134319607
[(1R,3S)-1-amino-3-(2-hexoxy-4,5-dihydrobenzo[g][1,3]benzothiazol-7-yl)cyclopentyl]methanol (PubChem CID 134319607) has the molecular formula C23H32N2O2S and a molecular weight of 400.59 g/mol. Its IUPAC name is [(1R,3S)-1-amino-3-(2-hexoxy-4,5-dihydrobenzo[g][1,3]benzothiazol-7-yl)cyclopentyl]methanol.
| Compound Name | [(1R,3S)-1-amino-3-(2-hexoxy-4,5-dihydrobenzo[g][1,3]benzothiazol-7-yl)cyclopentyl]methanol |
|---|---|
| PubChem CID | 134319607 |
| Molecular Formula | C23H32N2O2S |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | [(1R,3S)-1-amino-3-(2-hexoxy-4,5-dihydrobenzo[g][1,3]benzothiazol-7-yl)cyclopentyl]methanol |
| SMILES | CCCCCCOc1nc2c(s1)-c1ccc([C@H]3CC[C@](N)(CO)C3)cc1CC2 |
| InChI | InChI=1S/C23H32N2O2S/c1-2-3-4-5-12-27-22-25-20-9-7-17-13-16(6-8-19(17)21(20)28-22)18-10-11-23(24,14-18)15-26/h6,8,13,18,26H,2-5,7,9-12,14-15,24H2,1H3/t18-,23+/m0/s1 |
| InChIKey | PRVPBQJNLLGERZ-FDDCHVKYSA-N |
| XLogP | 4.83 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|