C20H33O4P — CID 11995898
[1-(hydroxymethyl)-3-(4-octylphenyl)cyclopentyl]phosphonic acid (PubChem CID 11995898) has the molecular formula C20H33O4P and a molecular weight of 368.45 g/mol. Its IUPAC name is [1-(hydroxymethyl)-3-(4-octylphenyl)cyclopentyl]phosphonic acid.
| Compound Name | [1-(hydroxymethyl)-3-(4-octylphenyl)cyclopentyl]phosphonic acid |
|---|---|
| PubChem CID | 11995898 |
| Molecular Formula | C20H33O4P |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | [1-(hydroxymethyl)-3-(4-octylphenyl)cyclopentyl]phosphonic acid |
| SMILES | CCCCCCCCc1ccc(C2CCC(CO)(P(=O)(O)O)C2)cc1 |
| InChI | InChI=1S/C20H33O4P/c1-2-3-4-5-6-7-8-17-9-11-18(12-10-17)19-13-14-20(15-19,16-21)25(22,23)24/h9-12,19,21H,2-8,13-16H2,1H3,(H2,22,23,24) |
| InChIKey | XZTUQODEWAHKGP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|