C25H41NO3 — CID 134956578
tert-butyl N-[(1S,3S)-1-(hydroxymethyl)-3-(4-octylphenyl)cyclopentyl]carbamate (PubChem CID 134956578) has the molecular formula C25H41NO3 and a molecular weight of 403.61 g/mol. Its IUPAC name is tert-butyl N-[(1S,3S)-1-(hydroxymethyl)-3-(4-octylphenyl)cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1S,3S)-1-(hydroxymethyl)-3-(4-octylphenyl)cyclopentyl]carbamate |
|---|---|
| PubChem CID | 134956578 |
| Molecular Formula | C25H41NO3 |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.31 |
| IUPAC Name | tert-butyl N-[(1S,3S)-1-(hydroxymethyl)-3-(4-octylphenyl)cyclopentyl]carbamate |
| SMILES | CCCCCCCCc1ccc([C@H]2CC[C@](CO)(NC(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C25H41NO3/c1-5-6-7-8-9-10-11-20-12-14-21(15-13-20)22-16-17-25(18-22,19-27)26-23(28)29-24(2,3)4/h12-15,22,27H,5-11,16-19H2,1-4H3,(H,26,28)/t22-,25-/m0/s1 |
| InChIKey | RELBLQNOACUVFW-DHLKQENFSA-N |
| XLogP | 6.11 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|