C20H33NO4 — CID 170832962
tert-butyl N-[3-(4-hexylphenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170832962) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is tert-butyl N-[3-(4-hexylphenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-hexylphenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170832962 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | tert-butyl N-[3-(4-hexylphenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | CCCCCCc1ccc(C(O)C(O)CNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H33NO4/c1-5-6-7-8-9-15-10-12-16(13-11-15)18(23)17(22)14-21-19(24)25-20(2,3)4/h10-13,17-18,22-23H,5-9,14H2,1-4H3,(H,21,24) |
| InChIKey | RZHMJMSNJYWINE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|