C21H26O2 — CID 143710483
[(1S)-3-[4-(3-phenylpropoxy)phenyl]cyclopentyl]methanol (PubChem CID 143710483) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is [(1S)-3-[4-(3-phenylpropoxy)phenyl]cyclopentyl]methanol.
| Compound Name | [(1S)-3-[4-(3-phenylpropoxy)phenyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 143710483 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | [(1S)-3-[4-(3-phenylpropoxy)phenyl]cyclopentyl]methanol |
| SMILES | OC[C@H]1CCC(c2ccc(OCCCc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C21H26O2/c22-16-18-8-9-20(15-18)19-10-12-21(13-11-19)23-14-4-7-17-5-2-1-3-6-17/h1-3,5-6,10-13,18,20,22H,4,7-9,14-16H2/t18-,20?/m0/s1 |
| InChIKey | JHGBMEUWQYAPFJ-LROBGIAVSA-N |
| XLogP | 4.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|