C20H23O6P — CID 143710547
3-[[(1S)-3-[4-(2-phenoxyethoxy)phenyl]cyclopentyl]methoxy]-1,2,3λ5-dioxaphosphirane 3-oxide (PubChem CID 143710547) has the molecular formula C20H23O6P and a molecular weight of 390.37 g/mol. Its IUPAC name is 3-[[(1S)-3-[4-(2-phenoxyethoxy)phenyl]cyclopentyl]methoxy]-1,2,3λ5-dioxaphosphirane 3-oxide.
| Compound Name | 3-[[(1S)-3-[4-(2-phenoxyethoxy)phenyl]cyclopentyl]methoxy]-1,2,3λ5-dioxaphosphirane 3-oxide |
|---|---|
| PubChem CID | 143710547 |
| Molecular Formula | C20H23O6P |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 3-[[(1S)-3-[4-(2-phenoxyethoxy)phenyl]cyclopentyl]methoxy]-1,2,3λ5-dioxaphosphirane 3-oxide |
| SMILES | O=P1(OC[C@H]2CCC(c3ccc(OCCOc4ccccc4)cc3)C2)OO1 |
| InChI | InChI=1S/C20H23O6P/c21-27(25-26-27)24-15-16-6-7-18(14-16)17-8-10-20(11-9-17)23-13-12-22-19-4-2-1-3-5-19/h1-5,8-11,16,18H,6-7,12-15H2/t16-,18?/m0/s1 |
| InChIKey | LHDRNDSXZWDBNI-ATNAJCNCSA-N |
| XLogP | 5.11 |
| TPSA | 69.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|