C22H29O6P — CID 143710411
[3-[4-[3-(4-methoxyphenyl)propoxy]phenyl]cyclopentyl]methyl dihydrogen phosphate (PubChem CID 143710411) has the molecular formula C22H29O6P and a molecular weight of 420.44 g/mol. Its IUPAC name is [3-[4-[3-(4-methoxyphenyl)propoxy]phenyl]cyclopentyl]methyl dihydrogen phosphate.
| Compound Name | [3-[4-[3-(4-methoxyphenyl)propoxy]phenyl]cyclopentyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 143710411 |
| Molecular Formula | C22H29O6P |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [3-[4-[3-(4-methoxyphenyl)propoxy]phenyl]cyclopentyl]methyl dihydrogen phosphate |
| SMILES | COc1ccc(CCCOc2ccc(C3CCC(COP(=O)(O)O)C3)cc2)cc1 |
| InChI | InChI=1S/C22H29O6P/c1-26-21-10-5-17(6-11-21)3-2-14-27-22-12-8-19(9-13-22)20-7-4-18(15-20)16-28-29(23,24)25/h5-6,8-13,18,20H,2-4,7,14-16H2,1H3,(H2,23,24,25) |
| InChIKey | FOZNZBPGAVJNFB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|