C20H26ClNO — CID 18784188
N-benzyl-1-[3-(4-methoxyphenyl)cyclopentyl]methanamine;hydrochloride (PubChem CID 18784188) has the molecular formula C20H26ClNO and a molecular weight of 331.89 g/mol. Its IUPAC name is N-benzyl-1-[3-(4-methoxyphenyl)cyclopentyl]methanamine;hydrochloride.
| Compound Name | N-benzyl-1-[3-(4-methoxyphenyl)cyclopentyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 18784188 |
| Molecular Formula | C20H26ClNO |
| Molecular Weight | 331.89 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | N-benzyl-1-[3-(4-methoxyphenyl)cyclopentyl]methanamine;hydrochloride |
| SMILES | COc1ccc(C2CCC(CNCc3ccccc3)C2)cc1.Cl |
| InChI | InChI=1S/C20H25NO.ClH/c1-22-20-11-9-18(10-12-20)19-8-7-17(13-19)15-21-14-16-5-3-2-4-6-16;/h2-6,9-12,17,19,21H,7-8,13-15H2,1H3;1H |
| InChIKey | QQYZSAPBFUVJTL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.89 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |