About benzaldehyde;N-benzyl-1-cyclopropylmethanamine
benzaldehyde;N-benzyl-1-cyclopropylmethanamine (PubChem CID 158539783) has the molecular formula C18H21NO
and a molecular weight of 267.37 g/mol. Its IUPAC name is benzaldehyde;N-benzyl-1-cyclopropylmethanamine.
Molecular Properties
| Compound Name | benzaldehyde;N-benzyl-1-cyclopropylmethanamine |
| PubChem CID | 158539783 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | benzaldehyde;N-benzyl-1-cyclopropylmethanamine |
| SMILES | O=Cc1ccccc1.c1ccc(CNCC2CC2)cc1 |
| InChI | InChI=1S/C11H15N.C7H6O/c1-2-4-10(5-3-1)8-12-9-11-6-7-11;8-6-7-4-2-1-3-5-7/h1-5,11-12H,6-9H2;1-6H |
| InChIKey | HOJMONGSKYLYAM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze benzaldehyde;N-benzyl-1-cyclopropylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzaldehyde;N-benzyl-1-cyclopropylmethanamine?
The IUPAC name of benzaldehyde;N-benzyl-1-cyclopropylmethanamine (CID 158539783) is benzaldehyde;N-benzyl-1-cyclopropylmethanamine.
What is the SMILES notation for benzaldehyde;N-benzyl-1-cyclopropylmethanamine?
The canonical SMILES for benzaldehyde;N-benzyl-1-cyclopropylmethanamine is O=Cc1ccccc1.c1ccc(CNCC2CC2)cc1.
What is the InChIKey of benzaldehyde;N-benzyl-1-cyclopropylmethanamine?
The InChIKey is HOJMONGSKYLYAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.C7H6O/c1-2-4-10(5-3-1)8-12-9-11-6-7-11;8-6-7-4-2-1-3-5-7/h1-5,11-12H,6-9H2;1-6H.
What are the key properties of benzaldehyde;N-benzyl-1-cyclopropylmethanamine?
benzaldehyde;N-benzyl-1-cyclopropylmethanamine has a molecular weight of 267.37 g/mol, XLogP of 3.69, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzaldehyde;N-benzyl-1-cyclopropylmethanamine is sourced from PubChem (CID 158539783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).