C21H30NO6P — CID 59655591
[(2R)-2-amino-4-[4-[3-(4-methoxyphenyl)propoxy]phenyl]-2-methylbutyl] dihydrogen phosphate (PubChem CID 59655591) has the molecular formula C21H30NO6P and a molecular weight of 423.45 g/mol. Its IUPAC name is [(2R)-2-amino-4-[4-[3-(4-methoxyphenyl)propoxy]phenyl]-2-methylbutyl] dihydrogen phosphate.
| Compound Name | [(2R)-2-amino-4-[4-[3-(4-methoxyphenyl)propoxy]phenyl]-2-methylbutyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 59655591 |
| Molecular Formula | C21H30NO6P |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | [(2R)-2-amino-4-[4-[3-(4-methoxyphenyl)propoxy]phenyl]-2-methylbutyl] dihydrogen phosphate |
| SMILES | COc1ccc(CCCOc2ccc(CC[C@@](C)(N)COP(=O)(O)O)cc2)cc1 |
| InChI | InChI=1S/C21H30NO6P/c1-21(22,16-28-29(23,24)25)14-13-18-7-11-20(12-8-18)27-15-3-4-17-5-9-19(26-2)10-6-17/h5-12H,3-4,13-16,22H2,1-2H3,(H2,23,24,25)/t21-/m1/s1 |
| InChIKey | FNGOKCZSEIWLEE-OAQYLSRUSA-N |
| XLogP | 3.47 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|