C21H27NO4 — CID 11152514
1-[4-(2-amino-3-hydroxy-2-methylpropoxy)phenyl]-4-(4-methoxyphenyl)butan-1-one (PubChem CID 11152514) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is 1-[4-(2-amino-3-hydroxy-2-methylpropoxy)phenyl]-4-(4-methoxyphenyl)butan-1-one.
| Compound Name | 1-[4-(2-amino-3-hydroxy-2-methylpropoxy)phenyl]-4-(4-methoxyphenyl)butan-1-one |
|---|---|
| PubChem CID | 11152514 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 1-[4-(2-amino-3-hydroxy-2-methylpropoxy)phenyl]-4-(4-methoxyphenyl)butan-1-one |
| SMILES | COc1ccc(CCCC(=O)c2ccc(OCC(C)(N)CO)cc2)cc1 |
| InChI | InChI=1S/C21H27NO4/c1-21(22,14-23)15-26-19-12-8-17(9-13-19)20(24)5-3-4-16-6-10-18(25-2)11-7-16/h6-13,23H,3-5,14-15,22H2,1-2H3 |
| InChIKey | SQPOFCVCIHNLQC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |