C26H35NO7 — CID 118707203
1-[4-[[(2S)-2-amino-3-hydroxy-2-methylpropoxy]methyl]-3-ethylphenyl]-4-(4-methylphenyl)butan-1-one;oxalic acid (PubChem CID 118707203) has the molecular formula C26H35NO7 and a molecular weight of 473.57 g/mol. Its IUPAC name is 1-[4-[[(2S)-2-amino-3-hydroxy-2-methylpropoxy]methyl]-3-ethylphenyl]-4-(4-methylphenyl)butan-1-one;oxalic acid.
| Compound Name | 1-[4-[[(2S)-2-amino-3-hydroxy-2-methylpropoxy]methyl]-3-ethylphenyl]-4-(4-methylphenyl)butan-1-one;oxalic acid |
|---|---|
| PubChem CID | 118707203 |
| Molecular Formula | C26H35NO7 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | 1-[4-[[(2S)-2-amino-3-hydroxy-2-methylpropoxy]methyl]-3-ethylphenyl]-4-(4-methylphenyl)butan-1-one;oxalic acid |
| SMILES | CCc1cc(C(=O)CCCc2ccc(C)cc2)ccc1COC[C@@](C)(N)CO.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H33NO3.C2H2O4/c1-4-20-14-21(12-13-22(20)15-28-17-24(3,25)16-26)23(27)7-5-6-19-10-8-18(2)9-11-19;3-1(4)2(5)6/h8-14,26H,4-7,15-17,25H2,1-3H3;(H,3,4)(H,5,6)/t24-;/m0./s1 |
| InChIKey | WITUVHMWAJNGHP-JIDHJSLPSA-N |
| XLogP | 3.14 |
| TPSA | 147.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|