C21H26ClNO3 — CID 11291814
1-[4-[(2-amino-3-hydroxy-2-methylpropoxy)methyl]-3-chlorophenyl]-4-phenylbutan-1-one (PubChem CID 11291814) has the molecular formula C21H26ClNO3 and a molecular weight of 375.90 g/mol. Its IUPAC name is 1-[4-[(2-amino-3-hydroxy-2-methylpropoxy)methyl]-3-chlorophenyl]-4-phenylbutan-1-one.
| Compound Name | 1-[4-[(2-amino-3-hydroxy-2-methylpropoxy)methyl]-3-chlorophenyl]-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 11291814 |
| Molecular Formula | C21H26ClNO3 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 1-[4-[(2-amino-3-hydroxy-2-methylpropoxy)methyl]-3-chlorophenyl]-4-phenylbutan-1-one |
| SMILES | CC(N)(CO)COCc1ccc(C(=O)CCCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C21H26ClNO3/c1-21(23,14-24)15-26-13-18-11-10-17(12-19(18)22)20(25)9-5-8-16-6-3-2-4-7-16/h2-4,6-7,10-12,24H,5,8-9,13-15,23H2,1H3 |
| InChIKey | JLAXLLAYLCAGKV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |