C21H29NO3S — CID 22279678
1-[5-(3-amino-4-hydroxy-3-methylbutyl)thiophen-2-yl]-5-(4-methoxyphenyl)pentan-1-one (PubChem CID 22279678) has the molecular formula C21H29NO3S and a molecular weight of 375.53 g/mol. Its IUPAC name is 1-[5-(3-amino-4-hydroxy-3-methylbutyl)thiophen-2-yl]-5-(4-methoxyphenyl)pentan-1-one.
| Compound Name | 1-[5-(3-amino-4-hydroxy-3-methylbutyl)thiophen-2-yl]-5-(4-methoxyphenyl)pentan-1-one |
|---|---|
| PubChem CID | 22279678 |
| Molecular Formula | C21H29NO3S |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 1-[5-(3-amino-4-hydroxy-3-methylbutyl)thiophen-2-yl]-5-(4-methoxyphenyl)pentan-1-one |
| SMILES | COc1ccc(CCCCC(=O)c2ccc(CCC(C)(N)CO)s2)cc1 |
| InChI | InChI=1S/C21H29NO3S/c1-21(22,15-23)14-13-18-11-12-20(26-18)19(24)6-4-3-5-16-7-9-17(25-2)10-8-16/h7-12,23H,3-6,13-15,22H2,1-2H3 |
| InChIKey | ABCIWELVOCHOST-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|