C22H32NO6PS — CID 23031434
[2-amino-4-[5-[5-(4-ethoxyphenyl)pentanoyl]thiophen-2-yl]-2-methylbutyl] dihydrogen phosphate (PubChem CID 23031434) has the molecular formula C22H32NO6PS and a molecular weight of 469.54 g/mol. Its IUPAC name is [2-amino-4-[5-[5-(4-ethoxyphenyl)pentanoyl]thiophen-2-yl]-2-methylbutyl] dihydrogen phosphate.
| Compound Name | [2-amino-4-[5-[5-(4-ethoxyphenyl)pentanoyl]thiophen-2-yl]-2-methylbutyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 23031434 |
| Molecular Formula | C22H32NO6PS |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | [2-amino-4-[5-[5-(4-ethoxyphenyl)pentanoyl]thiophen-2-yl]-2-methylbutyl] dihydrogen phosphate |
| SMILES | CCOc1ccc(CCCCC(=O)c2ccc(CCC(C)(N)COP(=O)(O)O)s2)cc1 |
| InChI | InChI=1S/C22H32NO6PS/c1-3-28-18-10-8-17(9-11-18)6-4-5-7-20(24)21-13-12-19(31-21)14-15-22(2,23)16-29-30(25,26)27/h8-13H,3-7,14-16,23H2,1-2H3,(H2,25,26,27) |
| InChIKey | KRCGSNSSJKYXCH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|