C21H30NO5PS — CID 23031289
[3-amino-3-methyl-5-[5-[4-(4-methylphenoxy)butanoyl]thiophen-2-yl]pentyl]phosphonic acid (PubChem CID 23031289) has the molecular formula C21H30NO5PS and a molecular weight of 439.51 g/mol. Its IUPAC name is [3-amino-3-methyl-5-[5-[4-(4-methylphenoxy)butanoyl]thiophen-2-yl]pentyl]phosphonic acid.
| Compound Name | [3-amino-3-methyl-5-[5-[4-(4-methylphenoxy)butanoyl]thiophen-2-yl]pentyl]phosphonic acid |
|---|---|
| PubChem CID | 23031289 |
| Molecular Formula | C21H30NO5PS |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | [3-amino-3-methyl-5-[5-[4-(4-methylphenoxy)butanoyl]thiophen-2-yl]pentyl]phosphonic acid |
| SMILES | Cc1ccc(OCCCC(=O)c2ccc(CCC(C)(N)CCP(=O)(O)O)s2)cc1 |
| InChI | InChI=1S/C21H30NO5PS/c1-16-5-7-17(8-6-16)27-14-3-4-19(23)20-10-9-18(29-20)11-12-21(2,22)13-15-28(24,25)26/h5-10H,3-4,11-15,22H2,1-2H3,(H2,24,25,26) |
| InChIKey | PLUOEUYMMPDNAQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|