C20H30NO4PS2 — CID 18448135
[3-amino-3-methyl-5-[5-[5-(4-methylthiophen-2-yl)pentanoyl]thiophen-2-yl]pentyl]phosphonic acid (PubChem CID 18448135) has the molecular formula C20H30NO4PS2 and a molecular weight of 443.57 g/mol. Its IUPAC name is [3-amino-3-methyl-5-[5-[5-(4-methylthiophen-2-yl)pentanoyl]thiophen-2-yl]pentyl]phosphonic acid.
| Compound Name | [3-amino-3-methyl-5-[5-[5-(4-methylthiophen-2-yl)pentanoyl]thiophen-2-yl]pentyl]phosphonic acid |
|---|---|
| PubChem CID | 18448135 |
| Molecular Formula | C20H30NO4PS2 |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | [3-amino-3-methyl-5-[5-[5-(4-methylthiophen-2-yl)pentanoyl]thiophen-2-yl]pentyl]phosphonic acid |
| SMILES | Cc1csc(CCCCC(=O)c2ccc(CCC(C)(N)CCP(=O)(O)O)s2)c1 |
| InChI | InChI=1S/C20H30NO4PS2/c1-15-13-17(27-14-15)5-3-4-6-18(22)19-8-7-16(28-19)9-10-20(2,21)11-12-26(23,24)25/h7-8,13-14H,3-6,9-12,21H2,1-2H3,(H2,23,24,25) |
| InChIKey | ZDHPZEGQNXVWPV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|