C20H27O4PS — CID 141073841
5-[5-(5-phenylpentanoyl)thiophen-2-yl]pentylphosphonic acid (PubChem CID 141073841) has the molecular formula C20H27O4PS and a molecular weight of 394.47 g/mol. Its IUPAC name is 5-[5-(5-phenylpentanoyl)thiophen-2-yl]pentylphosphonic acid.
| Compound Name | 5-[5-(5-phenylpentanoyl)thiophen-2-yl]pentylphosphonic acid |
|---|---|
| PubChem CID | 141073841 |
| Molecular Formula | C20H27O4PS |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 5-[5-(5-phenylpentanoyl)thiophen-2-yl]pentylphosphonic acid |
| SMILES | O=C(CCCCc1ccccc1)c1ccc(CCCCCP(=O)(O)O)s1 |
| InChI | InChI=1S/C20H27O4PS/c21-19(13-7-6-11-17-9-3-1-4-10-17)20-15-14-18(26-20)12-5-2-8-16-25(22,23)24/h1,3-4,9-10,14-15H,2,5-8,11-13,16H2,(H2,22,23,24) |
| InChIKey | ATITUPOCXJKQFX-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|