C24H28NO3P — CID 164745604
6-[4-(N-phenylanilino)phenyl]hexylphosphonic acid (PubChem CID 164745604) has the molecular formula C24H28NO3P and a molecular weight of 409.47 g/mol. Its IUPAC name is 6-[4-(N-phenylanilino)phenyl]hexylphosphonic acid.
| Compound Name | 6-[4-(N-phenylanilino)phenyl]hexylphosphonic acid |
|---|---|
| PubChem CID | 164745604 |
| Molecular Formula | C24H28NO3P |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 6-[4-(N-phenylanilino)phenyl]hexylphosphonic acid |
| SMILES | O=P(O)(O)CCCCCCc1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H28NO3P/c26-29(27,28)20-10-2-1-5-11-21-16-18-24(19-17-21)25(22-12-6-3-7-13-22)23-14-8-4-9-15-23/h3-4,6-9,12-19H,1-2,5,10-11,20H2,(H2,26,27,28) |
| InChIKey | KCWGMYFWQQLGEG-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|